This compound is an isotopically labeled version of 2-bromopropane, where all six hydrogen atoms on the two methyl groups are replaced with deuterium. It is primarily used as a reference standard in analytical chemistry and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 52809-76-4
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
1-Methyl-1-propylpyrrolidinium chloride
Ionic liquid research compound
20-هيدروكسي ديسون
ecdysteroid hormone research compound
2-Bromopropane
organic synthesis intermediate
2-Bromopropane-d7
Deuterated research standard
2-Bromo(2-~2~H)propane
Deuterated research compound
2-bromo-1,1,1,3,3,3-hexadeuteriopropane
NAMYKGVDVNBCFQ-WFGJKAKNSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])Br