Fisetin is a naturally occurring flavonol found in many fruits and vegetables, recognized for its antioxidant properties and studied as a geroprotector and anti-inflammatory agent. It also functions as an inhibitor of DNA topoisomerase and is investigated in research settings for its potential roles in cellular health.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 528-48-3
Cyanidin chloride
assay reagent
2-Bromopropane-1,1,1,3,3,3-d6
Isotopically labeled reference standard
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
Quercetin dihydrate
Dietary supplement and food ingredient
Quercetin
dietary supplement ingredient
2-(3,4-Dihydroxyphenyl)-6-ethyl-3-hydroxychromen-4-one
research compound
Hibiscetin 3,7,4'-trimethyl ether
Research compound
2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one
XHEFDIBZLJXQHF-UHFFFAOYSA-N
C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O