Acetaminophen mercapturate is an S-substituted N-acetyl-L-cysteine derivative and a metabolite of paracetamol (acetaminophen). It is primarily significant as a human urinary metabolite reference standard used in analytical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 52372-86-8
3-(3-Hydroxyphenyl)-3-hydroxypropanoic acid
human urinary metabolite reference standard
Methyl (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
chiral building block for synthesis
(3-Bromopyridin-2-yl)methanol
research compound
Cyclopropaneacetic acid
research compound
(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; Palladium
palladium-catalyzed cross-coupling reactions catalyst
(2R)-2-acetamido-3-(5-acetamido-2-hydroxyphenyl)sulfanylpropanoic acid
DVPRQNKJGQEICH-JTQLQIEISA-N
CC(=O)NC1=CC(=C(C=C1)O)SC[C@@H](C(=O)O)NC(=O)C