3-(3-Hydroxyphenyl)-3-hydroxypropanoic acid is a dihydroxy monocarboxylic acid that serves as a human urinary metabolite. It is structurally characterized by a 3-hydroxyphenyl group attached to 3-hydroxypropanoic acid.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3247-75-4
Acetaminophen mercapturate
human urinary metabolite reference standard
Trideuterio(deuteriooxy)(113C)methane
Isotopically labeled methanol standard
3-METHOXYFURAN-2-CARBALDEHYDE
research compound
3-amino-3-(4-fluorophenyl)propanoic acid
glycine reuptake inhibitor
Tetrabutylammonium hydrogen sulfate
phase transfer catalyst
3-hydroxy-3-(3-hydroxyphenyl)propanoic acid
KHTAGVZHYUZYMF-UHFFFAOYSA-N
C1=CC(=CC(=C1)O)C(CC(=O)O)O