This compound is a protected amino acid derivative used as an intermediate in peptide synthesis. Its structure features a tert-butyloxycarbonyl (Boc) protecting group on the amine and a methyl ester on the side chain carboxyl, making it suitable for selective peptide chain assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 45214-91-3
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
Boc-L-glutamine
protected amino acid for peptide synthesis
(5R)-5-(2,2-Dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one
pharmaceutical intermediate
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
[3,3'-Bifuran]-2,2',5,5'-tetrone, tetrahydro-
Pharmaceutical intermediate
(2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
OHYMUFVCRVPMEY-ZETCQYMHSA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)O