Boc-L-glutamine is a protected amino acid derivative commonly used as a building block in peptide synthesis. The compound features a tert-butoxycarbonyl (Boc) protecting group attached to the alpha-amino group, which allows for selective deprotection during solid-phase or solution-phase peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13726-85-7
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanedioic acid
Peptide synthesis intermediate
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
Boc-lysine
protected amino acid for peptide synthesis
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
O-Benzyl-N-tert-butoxycarbonyl-L-threonine
protected amino acid for peptide synthesis
BOC-ALA
protected amino acid for peptide synthesis
Pemetrexed acid
pharmaceutical intermediate
(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
VVNYDCGZZSTUBC-LURJTMIESA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)N)C(=O)O