O-Benzyl-N-tert-butoxycarbonyl-L-threonine is a protected amino acid derivative used as a building block in peptide synthesis. Its structure features a tert-butoxycarbonyl (Boc) protecting group on the amino group and a benzyl ether protecting group on the hydroxyl side chain, enabling selective incorporation into peptide chains during solid-phase or solution-phase synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 15260-10-3
BOC-ALA
protected amino acid for peptide synthesis
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
Alloc-Lys(Fmoc)-OH
protected amino acid for peptide synthesis
N5-((((2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl)amino)iminomethyl)-N2-((1,1-dimethylethoxy)carbonyl)-D-ornithine
protected amino acid for peptide synthesis
4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid methyl ester
pharmaceutical intermediate
4-butyrylamino-3-methyl-5-nitrobenzoic acid methyl ester
Pharmaceutical intermediate for drug synthesis
1,7'-DIMETHYL-2'-PROPYL-1H,1'H-2,5'-BIBENZO[D]IMIDAZOLE
pharmaceutical intermediate
7-Methyl-2-propyl-1H-benzimidazole-5-carboxylic Acid
pharmaceutical intermediate
(2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoic acid
CTXPLTPDOISPTE-YPMHNXCESA-N
C[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OCC1=CC=CC=C1