4-Fluoro-3-nitrobenzoic acid is a chemical compound used primarily as a pharmaceutical intermediate. It features an aromatic ring substituted with fluorine and nitro groups, along with a carboxylic acid functional group, contributing to its polarity and reactivity in synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 453-71-4
3-Fluoro-4-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
[3,3'-Bifuran]-2,2',5,5'-tetrone, tetrahydro-
Pharmaceutical intermediate
3-hydroxyazetidine
pharmaceutical intermediate
3-Amino-5-fluorobenzotrifluoride
pharmaceutical intermediate
4-fluoro-3-nitrobenzoic acid
BOJWTAQWPVBIPG-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])F