3-Fluoro-4-nitrobenzoic acid is a fluorinated aromatic carboxylic acid used primarily as a pharmaceutical intermediate. Its structure features a nitro group and a fluorine atom on the benzene ring, contributing to its utility in medicinal chemistry and drug synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 403-21-4
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
2-Fluoro-4-nitrobenzoic acid
Pharmaceutical intermediate
Methyl 4-fluorobenzoate
Pharmaceutical intermediate
4-Fluorobenzoyl chloride
precursor to high-performance polymer PEEK
6-Fluoronicotinic acid
pharmaceutical intermediate
3-fluoro-4-nitrobenzoic acid
WVZBIQSKLXJFNX-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)O)F)[N+](=O)[O-]