3-Fluoro-4-nitrobenzoic acid is a fluorinated aromatic carboxylic acid used primarily as a pharmaceutical intermediate. Its structure features a nitro group and a fluorine atom on the benzene ring, contributing to its utility in medicinal chemistry and drug synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 3-Fluoro-4-nitrobenzoic acid؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
2-Fluoro-4-nitrobenzoic acid
Pharmaceutical intermediate
Methyl 4-fluorobenzoate
Pharmaceutical intermediate
4-Fluorobenzoyl chloride
precursor to high-performance polymer PEEK
6-Fluoronicotinic acid
pharmaceutical intermediate
3-fluoro-4-nitrobenzoic acid
WVZBIQSKLXJFNX-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)O)F)[N+](=O)[O-]
هل تبحث عن شراء 3-Fluoro-4-nitrobenzoic acid؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.