2-Fluoro-4-nitrobenzoic acid is an organic compound featuring both a carboxylic acid and a nitro group on a fluorinated aromatic ring. It is primarily used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 403-24-7
2-Fluoro-5-nitrobenzoic acid
Pharmaceutical intermediate for synthesis
Methyl 4-fluorobenzoate
Pharmaceutical intermediate
4-Fluorobenzoyl chloride
precursor to high-performance polymer PEEK
6-Fluoronicotinic acid
pharmaceutical intermediate
3-Fluorobenzonitrile
Pharmaceutical intermediate
2-fluoro-4-nitrobenzoic acid
MMWFMFZFCKADEL-UHFFFAOYSA-N
C1=CC(=C(C=C1[N+](=O)[O-])F)C(=O)O