3,4,5-Trimethoxybenzoyl chloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of phenethylamine derivatives, including mescaline. It features an aromatic ring substituted with three methoxy groups and an acyl chloride group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4521-61-3
2,5-Dimethoxybenzaldehyde
Pharmaceutical intermediate for phenethylamine synthesis
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
(5R)-5-(2,2-Dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one
pharmaceutical intermediate
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
3,4,5-trimethoxybenzoyl chloride
BUHYMJLFRZAFBF-UHFFFAOYSA-N
COC1=CC(=CC(=C1OC)OC)C(=O)Cl