5-Fluoro-2-nitrotoluene is an industrial chemical used primarily as a chemical intermediate. It is listed under California Proposition 65 as a substance known to the state to cause cancer or reproductive toxicity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 446-33-3
3-Fluoro-4-nitrotoluene
chemical intermediate for synthesis
Tetrapropylammonium hydroxide
Structure-directing agent for zeolite synthesis
4-Methylnonanoic acid
medium-chain fatty acid
2-(2-Ethoxyethoxy)ethyl methacrylate
Monomer for polymer synthesis
4-fluoro-2-methyl-1-nitrobenzene
JHFOWEGCZWLHNW-UHFFFAOYSA-N
CC1=C(C=CC(=C1)F)[N+](=O)[O-]