Tetrapropylammonium hydroxide is a quaternary ammonium compound commonly used as a structure-directing agent in the synthesis of zeolites. It serves as a precursor to important industrial and laboratory catalysts.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4499-86-9
Tetrapropylammonium iodide
Quaternary ammonium salt reagent
Tetrapropylammonium bromide
Phase transfer catalyst and research reagent
4-Methylnonanoic acid
medium-chain fatty acid
2-(2-Ethoxyethoxy)ethyl methacrylate
Monomer for polymer synthesis
Ethyl N~2~,N~6~-bis(oxomethylidene)-L-lysinate
diisocyanate monomer for polyurethane synthesis
2,5-Difluorotoluene
chemical intermediate for synthesis
tetrapropylazanium hydroxide
LPSKDVINWQNWFE-UHFFFAOYSA-M
CCC[N+](CCC)(CCC)CCC.[OH-]