Tetrapropylammonium bromide is a quaternary ammonium salt commonly employed as a phase transfer catalyst and a laboratory research reagent. It facilitates the transfer of reactants between immiscible phases, enabling reactions that would otherwise proceed slowly or not at all.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1941-30-6
Tetrapropylammonium hydroxide
Structure-directing agent for zeolite synthesis
Tetrapropylammonium iodide
Quaternary ammonium salt reagent
2-Diethylaminoethanethiol hydrochloride
research compound
EAI045
epidermal growth factor receptor antagonist
Ethyl 1-benzofuran-3-carboxylate
Research reagent
Phenethyl isocyanate
Hapten for research
tetrapropylazanium bromide
BGQMOFGZRJUORO-UHFFFAOYSA-M
CCC[N+](CCC)(CCC)CCC.[Br-]