3-Fluoro-4-nitrotoluene is an industrial chemical used primarily as a chemical intermediate in organic synthesis. It is listed under California Proposition 65 as a substance known to the state to cause cancer or reproductive toxicity based on animal studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 446-34-4
Tetrapropylammonium hydroxide
Structure-directing agent for zeolite synthesis
4-Methylnonanoic acid
medium-chain fatty acid
2-(2-Ethoxyethoxy)ethyl methacrylate
Monomer for polymer synthesis
Ethyl N~2~,N~6~-bis(oxomethylidene)-L-lysinate
diisocyanate monomer for polyurethane synthesis
2-fluoro-4-methyl-1-nitrobenzene
WZMOWQCNPFDWPA-UHFFFAOYSA-N
CC1=CC(=C(C=C1)[N+](=O)[O-])F