4-(2-Pyridyl)benzoic acid is a chemical compound used as a research reagent. It contains both aromatic rings and a carboxylic acid functional group, making it useful in laboratory syntheses and impurity studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4385-62-0
4-(4-pyridyl)benzoic acid
research compound
3-(Pyridin-3-yl)benzoic acid
research compound
3-(Pyridin-4-yl)benzoic acid
Research compound for crystallography studies
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
(2,2'-Bipyridyl)bis[2-(4-fluorophenyl)pyridine]iridium(III) hexafluorophosphate
organometallic research compound
4-pyridin-2-ylbenzaldehyde
Pharmaceutical intermediate
Bis [2- (2,4-difluorophenyl) -5-trifluoromethylpyridine] [1,10-phenanthroline] iridium hexafluorophosphate
research compound
TERT-BUTYL 2-(4-(PYRIDIN-2-YL)BENZYL)HYDRAZINECARBOXYLATE
pharmaceutical intermediate
4-pyridin-2-ylbenzoic acid
AQIPNZHMXANQRC-UHFFFAOYSA-N
C1=CC=NC(=C1)C2=CC=C(C=C2)C(=O)O