3-(Pyridin-4-yl)benzoic acid is a research compound used in crystallography studies. Its structure features both aromatic and heterocyclic rings, making it a subject of structural analysis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4385-78-8
10,10'-DIBROMO-9,9'-BIANTHRACENE
Research compound for crystallography studies
3,5-Difluorophenol
Research compound for crystallography studies
Ethyl (2Z)-2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene]acetate
Research compound for crystallography studies
(2-amino-5-ethylthiophen-3-yl)(2-chlorophenyl)methanone
Research compound for crystallography studies
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
6-(Trifluoromethyl)pyridine-3,4-diamine
research compound
2-Amino-6-methylbenzoic acid
research compound
2-((3,3-dibutyl-7-(methylthio)-1,1-dioxido-5-phenyl-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-8-yl)oxy)acetic acid
research compound
3-pyridin-4-ylbenzoic acid
IYGIZNZSONLPSI-UHFFFAOYSA-N
C1=CC(=CC(=C1)C(=O)O)C2=CC=NC=C2