This compound is a research reagent characterized by a benzothiazepine core structure with butyl, phenyl, and acetic acid substituents. Its significance lies in its use as a laboratory chemical for investigational studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 439088-13-8
Elobixibat
ileal bile acid transporter inhibitor
3,3-Dibutyl-8-hydroxy-7-(methylthio)-5-phenyl-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepine 1,1-dioxide
Pharmaceutical intermediate for research
7-Bromo-3,3-dibutyl-8-methoxy-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one
research compound for structural studies
[Rh COD (R)-Binap]BF4
chiral organometallic catalyst
2,3,4,5,6-Pentafluorobenzyl alcohol
fluorinated benzyl alcohol reagent
6,6'-Dimethyl-2,2'-bipyridine
ligand for metal coordination chemistry
2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1lambda6,5-benzothiazepin-8-yl)oxy]acetic acid
HLVCNERLDVNLEF-UHFFFAOYSA-N
CCCCC1(CN(C2=CC(=C(C=C2S(=O)(=O)C1)OCC(=O)O)SC)C3=CC=CC=C3)CCCC
—