This compound is a pharmaceutical intermediate featuring a tert-butyl carbamate protecting group attached to a hydrazine moiety, which is linked to a biphenyl system containing a pyridine ring. It is primarily used as a building block in the synthesis of more complex organic molecules for pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 198904-85-7
1,1-Dimethylethyl 2-[(2S,3S)-3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-hydroxy-4-phenylbutyl]-2-[[4-(2-pyridinyl)phenyl]methyl]hydrazinecarboxylate
Pharmaceutical Intermediate
(2S,3S)-3-Amino-4-phenyl-1-(1-(4-(pyridin-2-yl)benzyl)hydrazinyl)butan-2-ol trihydrochloride
pharmaceutical intermediate for atazanavir synthesis
Methyl pyrrolidine-3-carboxylate hydrochloride
pharmaceutical intermediate
(3R)-piperidin-3-ol hydrochloride
pharmaceutical intermediate
1,1-Dimethylethyl 2-[[4-(2-pyridinyl)phenyl]methylene]hydrazinecarboxylate
pharmaceutical intermediate
6-phenylpyridin-2-amine
research compound
4-(2-Pyridyl)benzoic acid
research compound
2-(4-tert-butylphenyl)pyridine
research compound
tert-butyl N-[(4-pyridin-2-ylphenyl)methylamino]carbamate
GIMJTKJSKPENNG-UHFFFAOYSA-N
CC(C)(C)OC(=O)NNCC1=CC=C(C=C1)C2=CC=CC=N2
—