Cbz-D-Homoserine lactone is a research compound featuring a benzyloxycarbonyl (Cbz) protecting group attached to the D-isomer of homoserine lactone. Its structure includes an aromatic ring and an ester-containing heterocyclic lactone ring, making it a useful building block in peptide synthesis and organic chemistry research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 41088-89-5
N-Carbobenzyloxy-D-serine-beta-lactone
beta-lactone pharmaceutical intermediate
(S)-BENZYL (2-OXOOXETAN-3-YL)CARBAMATE
research compound
Lithium diisopropylamide
strong base in organic synthesis
Cyclopropylboronic acid
boronic acid research reagent
Ethyl carbazate
research compound
Dimethyl(2-oxo-4-phenylbutyl)phosphonate
research compound
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
benzyl N-[(3R)-2-oxooxolan-3-yl]carbamate
FKWDZIFOVOUDAG-SNVBAGLBSA-N
C1COC(=O)[C@@H]1NC(=O)OCC2=CC=CC=C2