Dimethyl(2-oxo-4-phenylbutyl)phosphonate is a research compound containing a phosphonate ester group and an aromatic ring. It is primarily used as a laboratory reagent for chemical synthesis and investigative studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 41162-19-0
2,4-Dimethylpyrimidin-5-ol
research reagent
(1-2H1)Acetaldehyde
deuterium-labeled reference standard
Potassium tert-amylate
strong base reagent
3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanoacrylic acid
Research compound
1-dimethoxyphosphoryl-4-phenylbutan-2-one
ONYIBVIIOCEBIV-UHFFFAOYSA-N
COP(=O)(CC(=O)CCC1=CC=CC=C1)OC