N-Carbobenzyloxy-D-serine-beta-lactone is a chemical compound used as a pharmaceutical intermediate. It features a beta-lactone ring and a carbobenzyloxy protecting group, making it suitable for the synthesis of more complex pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 98632-91-8
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
Cbz-D-Homoserine lactone
research compound
(2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane
pharmaceutical intermediate for protease inhibitors
1-bromo-2-methoxy-3-nitrobenzene
Pharmaceutical intermediate for research
Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-, 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite]
nucleoside phosphoramidite for oligonucleotide synthesis
Adenosine, N-benzoyl-5'-O-(bis(4-methoxyphenyl)phenylmethyl)-2'-deoxy-, 3'-(2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite)
phosphoramidite for oligonucleotide synthesis
(S)-BENZYL (2-OXOOXETAN-3-YL)CARBAMATE
research compound
benzyl N-[(3R)-2-oxooxetan-3-yl]carbamate
CWFZPRQDHIUBDO-SECBINFHSA-N
C1[C@H](C(=O)O1)NC(=O)OCC2=CC=CC=C2