D-Phenylalanine-d5 is a deuterium-labeled variant of D-phenylalanine, where all five hydrogen atoms on the aromatic ring are replaced with deuterium. It is primarily used as a research reagent in studies involving amino acid metabolism and protein labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 362049-55-6
DL-Aspartic acid-d3
deuterated amino acid research reagent
1,3-Dioxolan-2-one-d4
deuterated research compound
2,5-dichlorobenzooxazole
research compound
2,6-Dichlorobenzoxazole
Research compound for organic synthesis
3-Chlorophenylmagnesium bromide
Grignard reagent for organic synthesis
L-Phenylalanine-2-d1
isotopically labeled research compound
L-Phenyl-d5-alanine
Deuterated research compound
فينيل ألانين
nutritional supplement and flavoring agent
(2R)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid
COLNVLDHVKWLRT-NQJMBGHTSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@H](C(=O)O)N)[2H])[2H]