DL-Aspartic acid-d3 is a deuterated form of aspartic acid used as a research reagent in biochemical and pharmaceutical studies. Its deuterium labeling allows for tracing and quantification in metabolic and analytical applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 14341-75-4
L-Aspartic acid-2,3,3-d3
isotopically labeled research reagent
D-Phenylalanine-d5
deuterated amino acid research reagent
L-Glutamine-d5
stable isotope labeled research standard
DL-Glutamic Acid-d5
deuterated analytical reference standard
2-Chlorothiophene-3-carbaldehyde
research compound
4-MethylDibenzofuran-6-boronicacid
research compound
2-amino-2,3,3-trideuteriobutanedioic acid
CKLJMWTZIZZHCS-FUDHJZNOSA-N
[2H]C([2H])(C(=O)O)C([2H])(C(=O)O)N