L-Aspartic acid-2,3,3-d3 is a deuterium-labeled form of the amino acid L-aspartic acid, where three hydrogen atoms are replaced with deuterium. It is primarily used as an isotopically labeled research reagent in biochemical and analytical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3842-25-9
DL-Aspartic acid-d3
deuterated amino acid research reagent
Propanoic acid-2,2-d2
isotopically labeled research reagent
2-Methylalanine-d6
isotopically labeled research reagent
(13C)-Methane
isotopically labeled research reagent
Dimethylamine-15N hydrochloride
isotopically labeled research reagent
D-Pipercolic acid HCl
research compound
Cy-vBRIDP
phosphine ligand for homogeneous catalysis
Bis(1,1-dimethylethyl)(1-methyl-2,2-diphenylethenyl)phosphine
phosphine ligand for catalysis
(2S)-2-amino-2,3,3-trideuteriobutanedioic acid
CKLJMWTZIZZHCS-RBXBQAPRSA-N
[2H][C@@](C(=O)O)(C([2H])([2H])C(=O)O)N