8-Bromoadenosine is a brominated derivative of adenosine, commonly used as a research reagent. Its structure features a bromine atom at the 8-position of the purine ring, contributing to its utility in biochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2946-39-6
8-Aminoadenosine
adenosine analogue research compound
Gallic acid-d2
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
2-bromo-5-phenylthiophene
research compound
(2R,3R,4S,5R)-2-(6-amino-8-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
VJUPMOPLUQHMLE-UUOKFMHZSA-N
C1=NC(=C2C(=N1)N(C(=N2)Br)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N