8-Aminoadenosine is a purine nucleoside analog featuring an amino group substitution at the 8-position of the adenine base. It is primarily used as a research reagent for studying adenosine receptor interactions and nucleotide metabolism.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3868-33-5
8-Bromoadenosine
research compound
4-Fluoroindole
organic synthesis building block
7-fluoro-1H-indole
Reagent for chemical synthesis
Lithium Tri-sec-butylborohydride
Mild reducing agent in organic synthesis
4-methoxybenzylmagnesium chloride
Grignard reagent for organic synthesis
(2R,3R,4S,5R)-2-(6,8-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
DVGWFQILDUEEGX-UUOKFMHZSA-N
C1=NC(=C2C(=N1)N(C(=N2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N