Gallic acid-d2 is a deuterium-labeled reference standard of gallic acid, specifically the This compound isotopologue. It is primarily used as an internal standard or tracer in analytical chemistry and research applications requiring quantification or tracking of gallic acid.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 294660-92-7
3-Hydroxyacetaminophen-d3
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
2-bromo-5-phenylthiophene
research compound
1,4,8,11-Tetraazacyclotetradecane
crown amine for metal coordination
Gallic acid
antioxidant, tanning agent, dyeing intermediate
2,6-dideuterio-3,4,5-trihydroxybenzoic acid
LNTHITQWFMADLM-QDNHWIQGSA-N
[2H]C1=C(C(=C(C(=C1O)O)O)[2H])C(=O)O