7-Nitroindazole is a small-molecule compound that selectively inhibits neuronal nitric oxide synthase, an enzyme involved in the production of nitric oxide and cellular signaling. It is primarily used as a research reagent in neurochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2942-42-9
8-Bromoadenosine
research compound
Gallic acid-d2
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
7-nitro-1H-indazole
PQCAUHUKTBHUSA-UHFFFAOYSA-N
C1=CC2=C(C(=C1)[N+](=O)[O-])NN=C2