2-Amino-4'-chlorobenzophenone is an organic compound that serves as a pharmaceutical intermediate. Its structure consists of an aminophenyl group and a chlorophenyl group linked by a ketone moiety, giving it moderate lipophilicity and a polar surface area suitable for synthetic transformations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2894-51-1
8-benzyl-8-azabicyclo[3.2.1]octan-3-one
pharmaceutical intermediate for tropane derivatives
2-(3,5-bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
Pharmaceutical intermediate for netupitant synthesis
L-Methionine ethyl ester hydrochloride
Pharmaceutical intermediate
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
(2-aminophenyl)-(4-chlorophenyl)methanone
APHLSUBLNQBFTM-UHFFFAOYSA-N
C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)N