This compound is a carboxylic acid derivative featuring two trifluoromethyl groups on an aromatic ring. It serves as a pharmaceutical intermediate, primarily used in the manufacturing process for the active pharmaceutical ingredient netupitant.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 289686-70-0
L-Methionine ethyl ester hydrochloride
Pharmaceutical intermediate
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
(2-Butyl-3-benzofuranyl)(4-ethoxy-3,5-diiodophenyl)methanone
Amiodarone impurity reference standard
3,5-Bis(trifluoromethyl)-alpha,N-dimethylbenzylamine
Pharmaceutical intermediate for research synthesis
2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid
ORLKRFYFNMCQIG-UHFFFAOYSA-N
CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O