Fmoc-Gly-OH is an Fmoc-protected glycine derivative widely used as a building block in solid-phase peptide synthesis. Its fluorenylmethoxycarbonyl (Fmoc) group provides temporary protection for the amino group, enabling sequential assembly of peptides.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 29022-11-5
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acetamido)acetic acid
peptide synthesis reagent
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)glycylglycylglycine
research compound for peptide synthesis
2-{2-[3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]acetamido}acetic acid
research compound for peptide synthesis
Fmoc-L-asparagine
Fmoc-protected amino acid for peptide synthesis
Fmoc-Ala-OH H2O
Fmoc-protected amino acid for peptide synthesis
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
FMoc-alpha-Me-D-Phe(2-F)-OH
Fmoc-protected amino acid for peptide synthesis
(2-Butyl-3-benzofuranyl)(4-ethoxy-3,5-diiodophenyl)methanone
Amiodarone impurity reference standard
2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid
NDKDFTQNXLHCGO-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)O