Fmoc-L-asparagine is an Fmoc-protected amino acid derivative used as a building block in solid-phase peptide synthesis. Its structure includes an amide side chain and a fluorenylmethoxycarbonyl protecting group, making it suitable for sequential assembly of peptides.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 71989-16-7
Fmoc-L-aspartic acid
research compound for peptide synthesis
N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-glutamine
Fmoc-protected amino acid for peptide synthesis
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
Fmoc-L-Propargylglycine
Fmoc-protected amino acid for peptide synthesis
Fmoc-Ala-OH H2O
Fmoc-protected amino acid for peptide synthesis
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
Fmoc-L-glutamic acid 5-tert-butyl ester
Protected amino acid for peptide synthesis
N6-(tert-Butoxycarbonyl)-N2-((9H-fluoren-9-ylmethoxy)carbonyl)-L-lysine
Protected lysine derivative for peptide synthesis
(2S)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid
YUGBZNJSGOBFOV-INIZCTEOSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)N)C(=O)O