tert-Butyl diethylphosphonoacetate is a research reagent commonly used in organic synthesis. It serves as a phosphonate building block for the construction of various chemical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 27784-76-5
(3-Iodophenyl)methanesulfonyl chloride
Research reagent for chemical synthesis
[4-(2-Methylpropoxy)phenyl]methanamine Hydrochloride
Research reagent for chemical synthesis
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
3-Chloro-4-pyridineboronic acid
Research reagent for chemical synthesis
Uridine-5'-diphosphate disodium salt
nucleotide sugar research reagent
Thymidine 5'-triphosphate sodium salt
Nucleotide triphosphate for molecular biology
5-Hydroxynicotinic acid
Research reagent
L-Glutamic Acid-d5
Deuterated amino acid analytical standard
tert-butyl 2-diethoxyphosphorylacetate
NFEGNISFSSLEGU-UHFFFAOYSA-N
CCOP(=O)(CC(=O)OC(C)(C)C)OCC
—