(3-Iodophenyl)methanesulfonyl chloride is a chemical compound used as a research reagent in organic synthesis. It features an aromatic ring substituted with iodine and a sulfonyl chloride group, making it a building block for further chemical modifications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 352708-55-5
[4-(2-Methylpropoxy)phenyl]methanamine Hydrochloride
Research reagent for chemical synthesis
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
3-Chloro-4-pyridineboronic acid
Research reagent for chemical synthesis
7-bromo-1H-indazole
Research reagent for chemical synthesis
4-fluoro-1H-pyrazole
research compound
Beta-Guanidinopropionic acid
creatine analogue for research
CYCLO(-ASP-ASP)
research compound
(R)-(-)-2-Amino-1-propanol
Research compound and synthetic intermediate
(3-iodophenyl)methanesulfonyl chloride
FWYCOHVQIFJXEL-UHFFFAOYSA-N
C1=CC(=CC(=C1)I)CS(=O)(=O)Cl