CYCLO(-ASP-ASP) is a cyclic dipeptide consisting of two aspartic acid residues linked in a cyclic structure. This compound is typically used as a research reagent in biochemical and pharmaceutical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 35309-53-6
(R)-(-)-2-Amino-1-propanol
Research compound and synthetic intermediate
(+)-Epicatechin
research compound
2-chloro-3-nitropyridine-4-carboxylic acid
building block for pharmaceutical synthesis
(R)-2-Azido-2-phenylacetyl chloride
Research reagent
CYCLO(-SER-SER)
research compound
Piperazine-2,5-dione
research compound
Cyclo(-Ala-Glu)
research compound
2-[(2S,5S)-5-(carboxymethyl)-3,6-dioxopiperazin-2-yl]acetic acid
NMAZZUSURHBTKP-IMJSIDKUSA-N
C([C@H]1C(=O)N[C@H](C(=O)N1)CC(=O)O)C(=O)O