This compound is a protected derivative of the amino acid lysine, featuring both Boc (tert-butyloxycarbonyl) and Cbz (benzyloxycarbonyl) protecting groups. It is primarily used as a building block in peptide synthesis, enabling the selective incorporation of lysine residues into peptide chains during laboratory and manufacturing processes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2389-45-9
(2S)-5-{[(benzyloxy)carbonyl]amino}-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid
protected amino acid building block
IN2-(benzyloxycarbonyl)-N6-(tert-butoxycarbonyl)-L-lysine
protected amino acid for peptide synthesis
N2,N6-Bis[(phenylmethoxy)carbonyl]-L-lysine
Protected amino acid for peptide synthesis
Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-4-((tert-butoxycarbonyl)amino)butanoate
protected amino acid intermediate
Boc-L-serine
protected amino acid for peptide synthesis
Boc-His(Trt)-OH, Nalpha-Boc-N(im)-trityl-L-histidine
protected amino acid for peptide synthesis
Fmoc-D-Lys(Dde)-OH
protected amino acid for peptide synthesis
Alloc-Lys(Fmoc)-OH
protected amino acid for peptide synthesis
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid
BDHUTRNYBGWPBL-HNNXBMFYSA-N
CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1=CC=CC=C1)C(=O)O