Boc-L-serine is a protected amino acid used in peptide synthesis. It is a white, water-soluble solid derived from serine, featuring a tert-butoxycarbonyl (Boc) protecting group on the amino group and a free carboxylic acid.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3262-72-4
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
research compound
Boc-Ser-Otbu
amino acid protecting group intermediate
Boc-His(Trt)-OH, Nalpha-Boc-N(im)-trityl-L-histidine
protected amino acid for peptide synthesis
Fmoc-D-Lys(Dde)-OH
protected amino acid for peptide synthesis
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid
protected amino acid for peptide synthesis
N-alpha-t-Butyloxycarbonyl-N-alpha-methyl-L-isoleucine
protected amino acid for peptide synthesis
Triphenylboroxin
Pharmaceutical intermediate
(-)-Di-p-toluoyl-L-tartaric acid
chiral resolving agent for pharmaceuticals
(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
FHOAKXBXYSJBGX-YFKPBYRVSA-N
CC(C)(C)OC(=O)N[C@@H](CO)C(=O)O