Triphenylboroxin is a chemical compound used as a pharmaceutical intermediate in manufacturing and research settings. Its structure features three aromatic rings and a central heterocyclic ring containing boron and oxygen atoms.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3262-89-3
(-)-Di-p-toluoyl-L-tartaric acid
chiral resolving agent for pharmaceuticals
17-(Acetyloxy)-6-methylenepregn-4-ene-3,20-dione
pharmaceutical intermediate
Imidazol-4-ylmethanol hydrochloride
pharmaceutical intermediate
Di-tert-butyl Glutamate Hydrochloride
Pharmaceutical intermediate for peptide synthesis
2,4,6-triphenyl-1,3,5,2,4,6-trioxatriborinane
VOXXGUAZBWSUSS-UHFFFAOYSA-N
B1(OB(OB(O1)C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4