This compound is a protected lysine derivative featuring two benzyloxycarbonyl (Cbz) protecting groups on the amino functions. It is primarily used as a building block in solid-phase peptide synthesis, allowing the selective incorporation of lysine residues with orthogonal protection.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 405-39-0
Boc-Lys(Z)-OH
protected amino acid for peptide synthesis
IN2-(benzyloxycarbonyl)-N6-(tert-butoxycarbonyl)-L-lysine
protected amino acid for peptide synthesis
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
Z-Lys(Fmoc)-OH
Protected lysine derivative for peptide synthesis
Chloromethyl Methyl Carbonate
chemical intermediate for pharmaceuticals
(R)-4-N-Cbz-piperazine-2-carboxylic acid methyl ester
Pharmaceutical intermediate
(1R,3R)-3-aminocyclohexanol
pharmaceutical intermediate
6-methyl-4-phenyl-3,4-dihydrochromen-2-one
Pharmaceutical intermediate
(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoic acid
BLZXFNUZFTZCFD-IBGZPJMESA-N
C1=CC=C(C=C1)COC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2