2,3,6-Trifluorobenzoic acid is a fluorinated aromatic carboxylic acid commonly used as a research reagent in organic synthesis. Its structure features a benzene ring substituted with three fluorine atoms and a carboxylic acid group, making it a building block for preparing more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2358-29-4
(S)-tert-Butyl 4-amino-3,3-difluoropyrrolidine-1-carboxylate
Research reagent for chemical synthesis
Tert-Butyl diethylphosphonoacetate
Research reagent for chemical synthesis
1,2-oxazole-3-carboxylic Acid
Research reagent for chemical synthesis
(3-Iodophenyl)methanesulfonyl chloride
Research reagent for chemical synthesis
3,5-diiodopyridin-2-amine
research compound
(2S)-2-[[(2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(2S)-2-[[(2S)-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl-methylamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanoyl]amino]-3-phenylpropanoic acid
ADC research reagent
2-dimethylphosphoryl-4-phenyl-aniline
research compound
4-Bromo-2-methylphenol
research compound
2,3,6-trifluorobenzoic acid
MGUPHQGQNHDGNK-UHFFFAOYSA-N
C1=CC(=C(C(=C1F)C(=O)O)F)F