Fmoc-beta-(2-quinolyl)-Ala-OH is a research reagent used as an amino acid building block. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group and a quinoline ring, making it suitable for solid-phase peptide synthesis and medicinal chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء Fmoc-beta-(2-quinolyl)-Ala-OH؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Benzyl (S)-6-(Boc-amino)-2-(Fmoc-amino)hexanoate
amino acid building block
2,6-difluoro-4-Hydroxybenzoic Acid
research compound
1-azido-2-(2-methoxyethoxy)ethane
Click chemistry azide reagent
Phenyl-d5-boronic acid
deuterated research reagent
3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid
research reagent for kinase inhibition
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid
IDOMHXAHHXHYMO-VWLOTQADSA-N
C1=CC=C2C(=C1)C=CC(=N2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35
هل تبحث عن شراء Fmoc-beta-(2-quinolyl)-Ala-OH؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.