2,6-Difluoro-4-hydroxybenzoic acid is a fluorinated aromatic carboxylic acid used as a research compound. Its structure consists of a benzoic acid core with two fluorine substituents and a hydroxyl group, contributing to its utility in synthetic chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 214917-68-7
1-azido-2-(2-methoxyethoxy)ethane
Click chemistry azide reagent
Phenyl-d5-boronic acid
deuterated research reagent
3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid
research reagent for kinase inhibition
(3S)-3-aminoazepan-2-one
research compound
2,6-difluoro-4-hydroxybenzoic acid
NFIQGYBXSJQLSR-UHFFFAOYSA-N
C1=C(C=C(C(=C1F)C(=O)O)F)O
—