Phenyl-d5-boronic acid is a deuterated research reagent in which the five hydrogen atoms on the phenyl ring are replaced by deuterium. It is primarily used in synthetic chemistry as a labeled building block for the preparation of deuterated organic compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 215527-70-1
3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid
research reagent for kinase inhibition
(3S)-3-aminoazepan-2-one
research compound
4-Acetamidobenzenesulfonyl azide
sulfonyl azide reagent
3-Isopropylbenzeneboronic acid
chemical intermediate for synthesis
Phenylboronic acid
n.a
(2,3,4,5,6-pentadeuteriophenyl)boronic acid
HXITXNWTGFUOAU-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])B(O)O)[2H])[2H]