3-Isopropylbenzeneboronic acid is a research reagent used as a chemical intermediate in organic synthesis. It features an aromatic ring and two hydroxyl groups on the boron atom, making it suitable for cross-coupling reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 216019-28-2
2-bromo-3-nitrothiophene
research compound
Methyl beta-alanyl-L-histidinate
research compound for biochemical studies
6-chloro-1,2,3,4-tetrahydroquinolin-4-one
research compound
(E)-N-(4-(4-amino-3-(5-chloro-3-methylbenzofuran-2-yl)-7-oxo-6,7-dihydro-2H-pyrazolo[3,4-d]pyridazin-2-yl)phenyl)-4-(dimethylamino)but-2-enamide
research compound
(3-propan-2-ylphenyl)boronic acid
QSWLFBMVIGQONC-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(C)C)(O)O