Fmoc-L-Glu(OtBu)-OH monohydrate is a protected amino acid derivative used as a building block in peptide synthesis. It features an Fmoc (fluorenylmethoxycarbonyl) protecting group on the amino group and a tert-butyl ester protecting the side-chain carboxyl group, with one molecule of water of hydration.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 204251-24-1
Fmoc-L-glutamic acid 5-tert-butyl ester
Protected amino acid for peptide synthesis
Fmoc-Aad(otBu)-OH
Protected amino acid for peptide synthesis
Fmoc-Glu(OtBu)-Phe-OH
Peptide synthesis intermediate
Benzyloxycarbonylasparagine
protected amino acid for peptide synthesis
Boc-Lys(Z)-OH
protected amino acid for peptide synthesis
Boc-L-serine
protected amino acid for peptide synthesis
Boc-His(Trt)-OH, Nalpha-Boc-N(im)-trityl-L-histidine
protected amino acid for peptide synthesis
Ethyl (1S,5R,6S)-5-(1-ethylpropoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate
Oseltamivir intermediate
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;hydrate
NMBGBVUJSPZRDD-BDQAORGHSA-N
CC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.O