Dopamine-d4 hydrochloride is an isotopically labeled form of dopamine, where four hydrogen atoms are replaced with deuterium. It is primarily used as a research compound for analytical and tracer studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 203633-19-6
L-Methionine-d3
isotopically labeled research compound
Mesityl-d10 oxide
isotopically labeled research compound
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
Propane-1,1-d2, 1-iodo-
isotopically labeled research compound
Benzene-d5, methyl-d3-
NMR solvent
Transportan (trifluoroacetate salt)
cell-penetrating peptide research tool
2-Aminopyridine-d6 naphthol
deuterated research compound
DL-Valine-2,3,4,4,4,5,5,5-d8
Deuterium-labeled amino acid standard
4-(2-amino-1,1,2,2-tetradeuterioethyl)benzene-1,2-diol;hydrochloride
CTENFNNZBMHDDG-URZLSVTISA-N
[2H]C([2H])(C1=CC(=C(C=C1)O)O)C([2H])([2H])N.Cl