l-Methionine-d3 is a deuterated form of the amino acid L-methionine, commonly used as an isotopically labeled research compound. It is primarily applied in analytical and metabolic studies to trace biochemical pathways or quantify methionine-related processes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13010-53-2
Dopamine-d4 hydrochloride
isotopically labeled research compound
Rac Ambrisentan-d3 Methyl Ester
isotopically labeled research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
Carbon-13C monoxide
isotopically labeled research compound
Propan-2-yl-oxocyclobutane carboxylate
research compound
1-Bromohexane-d13
Deuterated research reagent
Methyl 4,4-difluoropiperidine-2-carboxylate
research compound
(-)-tert-Butyl glycidyl ether
research compound
(2S)-2-amino-4-(trideuteriomethylsulfanyl)butanoic acid
FFEARJCKVFRZRR-OSIBIXDNSA-N
[2H]C([2H])([2H])SCC[C@@H](C(=O)O)N