2-Aminopyridine-d6 naphthol is a deuterated research compound, specifically an isotopically labeled derivative of 2-aminopyridine where all hydrogen atoms on the pyridine ring and the amino group are replaced by deuterium. It is primarily used as a laboratory reagent for stable isotope labeling studies in chemical and biochemical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 203784-57-0
DL-Valine-2,3,4,4,4,5,5,5-d8
Deuterium-labeled amino acid standard
Oxalohydroximoyl chloride
research reagent for synthesis
3-bromo-9H-fluorene
research compound
HEPES (D18)
deuterated buffer reagent
2-أمينو البيريدين
pharmaceutical intermediate for antihistamines and other drugs
2-Pyridinamine-d4
Deuterated research standard for analytical chemistry
N,N,3,4,5,6-hexadeuteriopyridin-2-amine
ICSNLGPSRYBMBD-UDDMDDBKSA-N
[2H]C1=C(C(=NC(=C1[2H])N([2H])[2H])[2H])[2H]