2,3,4,5-Tetradeuteriothiophene is a deuterated form of thiophene used as a research reagent. Its primary significance lies in providing a labeled compound for spectroscopic studies and mechanistic investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2036-39-7
Dopamine-d4 hydrochloride
isotopically labeled research compound
Benzene-d5, methyl-d3-
NMR solvent
Transportan (trifluoroacetate salt)
cell-penetrating peptide research tool
2-Aminopyridine-d6 naphthol
deuterated research compound
THIOPHENE-2,5-D2
deuterated research compound
Thiofuran
pharmaceutical intermediate and solvent
2,3,4,5-tetradeuteriothiophene
YTPLMLYBLZKORZ-RHQRLBAQSA-N
[2H]C1=C(SC(=C1[2H])[2H])[2H]